Mineral: | Tourmaline, Variety: Schorl
| Chemical Formula: | NaFe3+2Al6(BO3)3[Si6O18](OH)3(OH) | Size: | | Weight: | | Transparence: | | Quantity: | | Origin: | Palelni mine, Khetchel (Khat Che) village, Molo quarter, Momeik Township, Burma (Myanmar) | Unusual V- shaped Schorl crystal with good luster and crystal striation. The termination faces are not damaged only a bit irregular terminated and partly hosting muscovite. In between the two crystals there a small bridge of tiny crystals. Interesting black tourmaline specimen 
|
